C15H22O4 — CID 10106980
(2S,3S)-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentane-1,3-diol (PubChem CID 10106980) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S,3S)-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentane-1,3-diol.
| Compound Name | (2S,3S)-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 10106980 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (2S,3S)-5-(methoxymethoxy)-2-[(E)-2-phenylethenyl]pentane-1,3-diol |
| SMILES | COCOCC[C@H](O)[C@@H](/C=C/c1ccccc1)CO |
| InChI | InChI=1S/C15H22O4/c1-18-12-19-10-9-15(17)14(11-16)8-7-13-5-3-2-4-6-13/h2-8,14-17H,9-12H2,1H3/b8-7+/t14-,15-/m0/s1 |
| InChIKey | HLFYCDJJIIAOAN-JSMHICHCSA-N |
| XLogP | 1.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|