C12H21NO3S2 — CID 102590106
[2-(butylcarbamothioyloxy)-3-sulfanylpropyl] 2-methylprop-2-enoate (PubChem CID 102590106) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is [2-(butylcarbamothioyloxy)-3-sulfanylpropyl] 2-methylprop-2-enoate.
| Compound Name | [2-(butylcarbamothioyloxy)-3-sulfanylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102590106 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | [2-(butylcarbamothioyloxy)-3-sulfanylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CS)OC(=S)NCCCC |
| InChI | InChI=1S/C12H21NO3S2/c1-4-5-6-13-12(18)16-10(8-17)7-15-11(14)9(2)3/h10,17H,2,4-8H2,1,3H3,(H,13,18) |
| InChIKey | XTYHXJKDAOJFKV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|