C17H11ClO3 — CID 10286283
2-chloro-6H-naphtho[1,2-c]isochromene-1,8-diol (PubChem CID 10286283) has the molecular formula C17H11ClO3 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-chloro-6H-naphtho[1,2-c]isochromene-1,8-diol.
| Compound Name | 2-chloro-6H-naphtho[1,2-c]isochromene-1,8-diol |
|---|---|
| PubChem CID | 10286283 |
| Molecular Formula | C17H11ClO3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-chloro-6H-naphtho[1,2-c]isochromene-1,8-diol |
| SMILES | Oc1ccc2c(c1)COc1c-2ccc2c(O)c(Cl)ccc12 |
| InChI | InChI=1S/C17H11ClO3/c18-15-6-5-14-12(16(15)20)3-4-13-11-2-1-10(19)7-9(11)8-21-17(13)14/h1-7,19-20H,8H2 |
| InChIKey | NCGIONJFFCTJRG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |