C9H15IN2S — CID 102943738
5-heptan-4-yl-3-iodo-1,2,4-thiadiazole (PubChem CID 102943738) has the molecular formula C9H15IN2S and a molecular weight of 310.20 g/mol. Its IUPAC name is 5-heptan-4-yl-3-iodo-1,2,4-thiadiazole.
| Compound Name | 5-heptan-4-yl-3-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943738 |
| Molecular Formula | C9H15IN2S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 5-heptan-4-yl-3-iodo-1,2,4-thiadiazole |
| SMILES | CCCC(CCC)c1nc(I)ns1 |
| InChI | InChI=1S/C9H15IN2S/c1-3-5-7(6-4-2)8-11-9(10)12-13-8/h7H,3-6H2,1-2H3 |
| InChIKey | AXVDDYYKHGEEMJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|