C22H20N2O — CID 10314448
2-benzyl-6-methyl-5,10c-dihydro-3H-pyrrolo[3,4-c]carbazol-1-one (PubChem CID 10314448) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-benzyl-6-methyl-5,10c-dihydro-3H-pyrrolo[3,4-c]carbazol-1-one.
| Compound Name | 2-benzyl-6-methyl-5,10c-dihydro-3H-pyrrolo[3,4-c]carbazol-1-one |
|---|---|
| PubChem CID | 10314448 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-benzyl-6-methyl-5,10c-dihydro-3H-pyrrolo[3,4-c]carbazol-1-one |
| SMILES | Cn1c2c(c3ccccc31)C1C(=O)N(Cc3ccccc3)CC1=CC2 |
| InChI | InChI=1S/C22H20N2O/c1-23-18-10-6-5-9-17(18)21-19(23)12-11-16-14-24(22(25)20(16)21)13-15-7-3-2-4-8-15/h2-11,20H,12-14H2,1H3 |
| InChIKey | YNYMIOMGNXECFC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|