C11H20N2O — CID 103170875
[2-cyclobutyl-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine (PubChem CID 103170875) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [2-cyclobutyl-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine.
| Compound Name | [2-cyclobutyl-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103170875 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [2-cyclobutyl-1-(3,4-dihydro-2H-pyran-6-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCC1)C1=CCCCO1 |
| InChI | InChI=1S/C11H20N2O/c12-13-10(8-9-4-3-5-9)11-6-1-2-7-14-11/h6,9-10,13H,1-5,7-8,12H2 |
| InChIKey | WBABGFIGJXDBSW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|