C22H30FNO3S — CID 10319238
7-[(2R)-2-[(E,3S)-4-(4-fluoro-3-methylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid (PubChem CID 10319238) has the molecular formula C22H30FNO3S and a molecular weight of 407.55 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-4-(4-fluoro-3-methylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-4-(4-fluoro-3-methylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 10319238 |
| Molecular Formula | C22H30FNO3S |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-4-(4-fluoro-3-methylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
| SMILES | Cc1cc(C[C@H](O)/C=C/[C@H]2CCC(=S)N2CCCCCCC(=O)O)ccc1F |
| InChI | InChI=1S/C22H30FNO3S/c1-16-14-17(7-11-20(16)23)15-19(25)10-8-18-9-12-21(28)24(18)13-5-3-2-4-6-22(26)27/h7-8,10-11,14,18-19,25H,2-6,9,12-13,15H2,1H3,(H,26,27)/b10-8+/t18-,19+/m0/s1 |
| InChIKey | RECHJEXYNHZFMX-VKJZPDJHSA-N |
| XLogP | 4.42 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|