C12H15F5N2O — CID 103213726
2-[2-(2,2-difluoroethoxy)ethyl]-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 103213726) has the molecular formula C12H15F5N2O and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 103213726 |
| Molecular Formula | C12H15F5N2O |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-6-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | FC(F)COCCc1nc2c([nH]1)CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C12H15F5N2O/c13-10(14)6-20-4-3-11-18-8-2-1-7(12(15,16)17)5-9(8)19-11/h7,10H,1-6H2,(H,18,19) |
| InChIKey | CWAJKILLCYSMNW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|