C22H14O3 — CID 10336487
(1R,13S)-12,14-dioxahexacyclo[11.11.0.02,11.03,8.015,24.018,23]tetracosa-2(11),3,5,7,9,15(24),16,18,20,22-decaen-10-ol (PubChem CID 10336487) has the molecular formula C22H14O3 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1R,13S)-12,14-dioxahexacyclo[11.11.0.02,11.03,8.015,24.018,23]tetracosa-2(11),3,5,7,9,15(24),16,18,20,22-decaen-10-ol.
| Compound Name | (1R,13S)-12,14-dioxahexacyclo[11.11.0.02,11.03,8.015,24.018,23]tetracosa-2(11),3,5,7,9,15(24),16,18,20,22-decaen-10-ol |
|---|---|
| PubChem CID | 10336487 |
| Molecular Formula | C22H14O3 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (1R,13S)-12,14-dioxahexacyclo[11.11.0.02,11.03,8.015,24.018,23]tetracosa-2(11),3,5,7,9,15(24),16,18,20,22-decaen-10-ol |
| SMILES | Oc1cc2ccccc2c2c1O[C@@H]1Oc3ccc4ccccc4c3[C@H]21 |
| InChI | InChI=1S/C22H14O3/c23-16-11-13-6-2-4-8-15(13)19-20-18-14-7-3-1-5-12(14)9-10-17(18)24-22(20)25-21(16)19/h1-11,20,22-23H/t20-,22+/m1/s1 |
| InChIKey | UOFDCELMFISIES-IRLDBZIGSA-N |
| XLogP | 4.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |