C14H17NO — CID 103393870
3-(3,4-dihydro-2H-chromen-4-ylmethylidene)cyclobutan-1-amine (PubChem CID 103393870) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-ylmethylidene)cyclobutan-1-amine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylidene)cyclobutan-1-amine |
|---|---|
| PubChem CID | 103393870 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylidene)cyclobutan-1-amine |
| SMILES | NC1CC(=CC2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C14H17NO/c15-12-8-10(9-12)7-11-5-6-16-14-4-2-1-3-13(11)14/h1-4,7,11-12H,5-6,8-9,15H2/b10-7- |
| InChIKey | RGKNWZNJYVCYLU-YFHOEESVSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|