C10H13F3N4O — CID 103476371
[2-(2,2,2-trifluoroethoxymethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 103476371) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethoxymethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,2,2-trifluoroethoxymethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 103476371 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [2-(2,2,2-trifluoroethoxymethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(COCC(F)(F)F)nc2c1CCC2 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)5-18-4-8-15-7-3-1-2-6(7)9(16-8)17-14/h1-5,14H2,(H,15,16,17) |
| InChIKey | IVCLXVQGTBQXFD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|