C11H24ClNO3S — CID 103521709
N-(2-chloro-3-methoxypropyl)-N,3,3-trimethylbutane-1-sulfonamide (PubChem CID 103521709) has the molecular formula C11H24ClNO3S and a molecular weight of 285.84 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N,3,3-trimethylbutane-1-sulfonamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N,3,3-trimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521709 |
| Molecular Formula | C11H24ClNO3S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N,3,3-trimethylbutane-1-sulfonamide |
| SMILES | COCC(Cl)CN(C)S(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H24ClNO3S/c1-11(2,3)6-7-17(14,15)13(4)8-10(12)9-16-5/h10H,6-9H2,1-5H3 |
| InChIKey | VAEZBFTZYNGJTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|