C17H21NOSi — CID 10356482
4-methyl-1-phenyl-2-(2-trimethylsilylethynyl)-2,3-dihydropyridin-6-one (PubChem CID 10356482) has the molecular formula C17H21NOSi and a molecular weight of 283.45 g/mol. Its IUPAC name is 4-methyl-1-phenyl-2-(2-trimethylsilylethynyl)-2,3-dihydropyridin-6-one.
| Compound Name | 4-methyl-1-phenyl-2-(2-trimethylsilylethynyl)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 10356482 |
| Molecular Formula | C17H21NOSi |
| Molecular Weight | 283.45 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-methyl-1-phenyl-2-(2-trimethylsilylethynyl)-2,3-dihydropyridin-6-one |
| SMILES | CC1=CC(=O)N(c2ccccc2)C(C#C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H21NOSi/c1-14-12-16(10-11-20(2,3)4)18(17(19)13-14)15-8-6-5-7-9-15/h5-9,13,16H,12H2,1-4H3 |
| InChIKey | CCXGFBAFTNRUIN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|