C9H20N4O — CID 103646369
3-[[amino(propylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 103646369) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 3-[[amino(propylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[amino(propylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103646369 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 3-[[amino(propylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCCN/C(N)=N/CC(C)(C)C(N)=O |
| InChI | InChI=1S/C9H20N4O/c1-4-5-12-8(11)13-6-9(2,3)7(10)14/h4-6H2,1-3H3,(H2,10,14)(H3,11,12,13) |
| InChIKey | ILANBJWQHOGILS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|