C27H31N3O2 — CID 10365353
(E)-N,N-dimethyl-3-[4-[[6-(2-pyrrolidin-1-ylethoxy)isoquinolin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 10365353) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-[4-[[6-(2-pyrrolidin-1-ylethoxy)isoquinolin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N,N-dimethyl-3-[4-[[6-(2-pyrrolidin-1-ylethoxy)isoquinolin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10365353 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (E)-N,N-dimethyl-3-[4-[[6-(2-pyrrolidin-1-ylethoxy)isoquinolin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ccc(Cc2nccc3cc(OCCN4CCCC4)ccc23)cc1 |
| InChI | InChI=1S/C27H31N3O2/c1-29(2)27(31)12-9-21-5-7-22(8-6-21)19-26-25-11-10-24(20-23(25)13-14-28-26)32-18-17-30-15-3-4-16-30/h5-14,20H,3-4,15-19H2,1-2H3/b12-9+ |
| InChIKey | JNUNOIZIJNDQID-FMIVXFBMSA-N |
| XLogP | 4.40 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|