C23H45IO3Si — CID 10369535
tert-butyl-[[(4R,5R)-4-[(E,5R)-8-iodo-5,7-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]-dimethylsilane (PubChem CID 10369535) has the molecular formula C23H45IO3Si and a molecular weight of 524.60 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-4-[(E,5R)-8-iodo-5,7-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-4-[(E,5R)-8-iodo-5,7-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10369535 |
| Molecular Formula | C23H45IO3Si |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | tert-butyl-[[(4R,5R)-4-[(E,5R)-8-iodo-5,7-dimethyloct-7-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]methoxy]-dimethylsilane |
| SMILES | C/C(=C\I)C[C@H](C)CCCC[C@H]1OC(C)(C)OC[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45IO3Si/c1-18(14-19(2)15-24)12-10-11-13-21-20(16-25-23(6,7)27-21)17-26-28(8,9)22(3,4)5/h15,18,20-21H,10-14,16-17H2,1-9H3/b19-15+/t18-,20-,21-/m1/s1 |
| InChIKey | MDXDRVADSFADCV-OJJHXBFUSA-N |
| XLogP | 7.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|