C7H5F4N3O — CID 103733396
N,N-bis(cyanomethyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733396) has the molecular formula C7H5F4N3O and a molecular weight of 223.13 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N,N-bis(cyanomethyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733396 |
| Molecular Formula | C7H5F4N3O |
| Molecular Weight | 223.13 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | N,N-bis(cyanomethyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | N#CCN(CC#N)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F4N3O/c8-5(9)7(10,11)6(15)14(3-1-12)4-2-13/h5H,3-4H2 |
| InChIKey | SHWIYWYOGYSRAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|