About 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide
2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide (PubChem CID 10387341) has the molecular formula C21H27BrN2O2
and a molecular weight of 419.36 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide.
Molecular Properties
| Compound Name | 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide |
| PubChem CID | 10387341 |
| Molecular Formula | C21H27BrN2O2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide |
| SMILES | O=C(Nc1ccccc1)OCC[N+]1(Cc2ccccc2)CCCCC1.[Br-] |
| InChI | InChI=1S/C21H26N2O2.BrH/c24-21(22-20-12-6-2-7-13-20)25-17-16-23(14-8-3-9-15-23)18-19-10-4-1-5-11-19;/h1-2,4-7,10-13H,3,8-9,14-18H2;1H |
| InChIKey | IZIHJMCRHWQGSD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide?
The IUPAC name of 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide (CID 10387341) is 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide.
What is the SMILES notation for 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide?
The canonical SMILES for 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide is O=C(Nc1ccccc1)OCC[N+]1(Cc2ccccc2)CCCCC1.[Br-].
What is the InChIKey of 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide?
The InChIKey is IZIHJMCRHWQGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2.BrH/c24-21(22-20-12-6-2-7-13-20)25-17-16-23(14-8-3-9-15-23)18-19-10-4-1-5-11-19;/h1-2,4-7,10-13H,3,8-9,14-18H2;1H.
What are the key properties of 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide?
2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide has a molecular weight of 419.36 g/mol, XLogP of 1.44, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzylpiperidin-1-ium-1-yl)ethyl N-phenylcarbamate bromide is sourced from PubChem (CID 10387341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).