C8H9NOS2 — CID 10397874
2-(1,3,2-benzodithiazol-2-yl)ethanol (PubChem CID 10397874) has the molecular formula C8H9NOS2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(1,3,2-benzodithiazol-2-yl)ethanol.
| Compound Name | 2-(1,3,2-benzodithiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 10397874 |
| Molecular Formula | C8H9NOS2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 2-(1,3,2-benzodithiazol-2-yl)ethanol |
| SMILES | OCCN1Sc2ccccc2S1 |
| InChI | InChI=1S/C8H9NOS2/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4,10H,5-6H2 |
| InChIKey | XEROJKGSDBFKQR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|