C10H13NOS — CID 140969919
2-(2,4-dihydro-1,3-benzothiazin-3-yl)ethanol (PubChem CID 140969919) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-(2,4-dihydro-1,3-benzothiazin-3-yl)ethanol.
| Compound Name | 2-(2,4-dihydro-1,3-benzothiazin-3-yl)ethanol |
|---|---|
| PubChem CID | 140969919 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-(2,4-dihydro-1,3-benzothiazin-3-yl)ethanol |
| SMILES | OCCN1CSc2ccccc2C1 |
| InChI | InChI=1S/C10H13NOS/c12-6-5-11-7-9-3-1-2-4-10(9)13-8-11/h1-4,12H,5-8H2 |
| InChIKey | CBHYBLGQXITBJH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |