C23H37N5O6 — CID 10412844
(2S)-2-amino-2-[(4S,5R)-2,2-dimethyl-5-[10-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]decyl]-1,3-dioxolan-4-yl]ethanol (PubChem CID 10412844) has the molecular formula C23H37N5O6 and a molecular weight of 479.58 g/mol. Its IUPAC name is (2S)-2-amino-2-[(4S,5R)-2,2-dimethyl-5-[10-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]decyl]-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (2S)-2-amino-2-[(4S,5R)-2,2-dimethyl-5-[10-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]decyl]-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 10412844 |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (2S)-2-amino-2-[(4S,5R)-2,2-dimethyl-5-[10-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]decyl]-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)O[C@@H]([C@@H](N)CO)[C@@H](CCCCCCCCCCNc2ccc([N+](=O)[O-])c3nonc23)O1 |
| InChI | InChI=1S/C23H37N5O6/c1-23(2)32-19(22(33-23)16(24)15-29)11-9-7-5-3-4-6-8-10-14-25-17-12-13-18(28(30)31)21-20(17)26-34-27-21/h12-13,16,19,22,25,29H,3-11,14-15,24H2,1-2H3/t16-,19+,22-/m0/s1 |
| InChIKey | NUOGBNOIFIKEQI-NBCNXNJRSA-N |
| XLogP | 3.89 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|