C14H16O6 — CID 10423766
(1S,2S,7R,8R)-7,8-dimethoxy-5,10-dimethyl-4,11-dioxatricyclo[6.4.0.02,7]dodeca-5,9-diene-3,12-dione (PubChem CID 10423766) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1S,2S,7R,8R)-7,8-dimethoxy-5,10-dimethyl-4,11-dioxatricyclo[6.4.0.02,7]dodeca-5,9-diene-3,12-dione.
| Compound Name | (1S,2S,7R,8R)-7,8-dimethoxy-5,10-dimethyl-4,11-dioxatricyclo[6.4.0.02,7]dodeca-5,9-diene-3,12-dione |
|---|---|
| PubChem CID | 10423766 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1S,2S,7R,8R)-7,8-dimethoxy-5,10-dimethyl-4,11-dioxatricyclo[6.4.0.02,7]dodeca-5,9-diene-3,12-dione |
| SMILES | CO[C@]12C=C(C)OC(=O)[C@H]1[C@@H]1C(=O)OC(C)=C[C@@]12OC |
| InChI | InChI=1S/C14H16O6/c1-7-5-13(17-3)9(11(15)19-7)10-12(16)20-8(2)6-14(10,13)18-4/h5-6,9-10H,1-4H3/t9-,10-,13-,14-/m1/s1 |
| InChIKey | AOCQATWBJPOTMG-DMTCVQMQSA-N |
| XLogP | 0.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |