C12H12O7 — CID 101485823
8,10-dimethoxy-5,9,12-trioxapentacyclo[6.5.0.02,11.03,7.04,10]tridecane-6,13-dione (PubChem CID 101485823) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 8,10-dimethoxy-5,9,12-trioxapentacyclo[6.5.0.02,11.03,7.04,10]tridecane-6,13-dione.
| Compound Name | 8,10-dimethoxy-5,9,12-trioxapentacyclo[6.5.0.02,11.03,7.04,10]tridecane-6,13-dione |
|---|---|
| PubChem CID | 101485823 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 8,10-dimethoxy-5,9,12-trioxapentacyclo[6.5.0.02,11.03,7.04,10]tridecane-6,13-dione |
| SMILES | COC12OC3(OC)C4C(=O)OC1C4C1C2OC(=O)C13 |
| InChI | InChI=1S/C12H12O7/c1-15-11-5-3-4-6(11)10(14)18-8(4)12(16-2,19-11)7(3)17-9(5)13/h3-8H,1-2H3 |
| InChIKey | VPMSCKYAPHQLSH-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |