C13H15BrO9S — CID 132579385
[(1R,4R,6R,9S,10S,11R,12R)-4-bromo-5,5-dimethoxy-3,7-dioxo-2,8-dioxatetracyclo[7.2.1.04,11.06,10]dodecan-12-yl] methanesulfonate (PubChem CID 132579385) has the molecular formula C13H15BrO9S and a molecular weight of 427.23 g/mol. Its IUPAC name is [(1R,4R,6R,9S,10S,11R,12R)-4-bromo-5,5-dimethoxy-3,7-dioxo-2,8-dioxatetracyclo[7.2.1.04,11.06,10]dodecan-12-yl] methanesulfonate.
| Compound Name | [(1R,4R,6R,9S,10S,11R,12R)-4-bromo-5,5-dimethoxy-3,7-dioxo-2,8-dioxatetracyclo[7.2.1.04,11.06,10]dodecan-12-yl] methanesulfonate |
|---|---|
| PubChem CID | 132579385 |
| Molecular Formula | C13H15BrO9S |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | [(1R,4R,6R,9S,10S,11R,12R)-4-bromo-5,5-dimethoxy-3,7-dioxo-2,8-dioxatetracyclo[7.2.1.04,11.06,10]dodecan-12-yl] methanesulfonate |
| SMILES | COC1(OC)[C@@H]2C(=O)O[C@@H]3[C@@H](OS(C)(=O)=O)[C@@H]4OC(=O)[C@@]1(Br)[C@@H]4[C@@H]32 |
| InChI | InChI=1S/C13H15BrO9S/c1-19-13(20-2)6-4-5-8(22-11(16)12(5,13)14)9(23-24(3,17)18)7(4)21-10(6)15/h4-9H,1-3H3/t4-,5-,6+,7+,8-,9-,12+/m1/s1 |
| InChIKey | IRFYLHUUMMWQBP-DUAFSUFLSA-N |
| XLogP | -0.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|