C25H40O4S4 — CID 10437094
O-[(6R,10S)-8,8-dimethyl-20-methylsulfanylcarbothioyloxy-7,9-dioxatetracyclo[13.3.3.01,15.06,10]henicosan-17-yl] methylsulfanylmethanethioate (PubChem CID 10437094) has the molecular formula C25H40O4S4 and a molecular weight of 532.86 g/mol. Its IUPAC name is O-[(6R,10S)-8,8-dimethyl-20-methylsulfanylcarbothioyloxy-7,9-dioxatetracyclo[13.3.3.01,15.06,10]henicosan-17-yl] methylsulfanylmethanethioate.
| Compound Name | O-[(6R,10S)-8,8-dimethyl-20-methylsulfanylcarbothioyloxy-7,9-dioxatetracyclo[13.3.3.01,15.06,10]henicosan-17-yl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 10437094 |
| Molecular Formula | C25H40O4S4 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | O-[(6R,10S)-8,8-dimethyl-20-methylsulfanylcarbothioyloxy-7,9-dioxatetracyclo[13.3.3.01,15.06,10]henicosan-17-yl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC1CC23CCCC[C@@H]4OC(C)(C)O[C@@H]4CCCCC2(C1)CC(OC(=S)SC)C3 |
| InChI | InChI=1S/C25H40O4S4/c1-23(2)28-19-9-5-7-11-24-13-17(26-21(30)32-3)14-25(24,12-8-6-10-20(19)29-23)16-18(15-24)27-22(31)33-4/h17-20H,5-16H2,1-4H3/t17?,18?,19-,20+,24?,25? |
| InChIKey | TXBOFUHMJQTMIB-VEDSYVKXSA-N |
| XLogP | 7.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|