C12H5Br2Cl2N3O4S — CID 10459251
2,3-dichloro-6-(3,5-dibromo-2,6-dinitrophenyl)sulfanylaniline (PubChem CID 10459251) has the molecular formula C12H5Br2Cl2N3O4S and a molecular weight of 517.97 g/mol. Its IUPAC name is 2,3-dichloro-6-(3,5-dibromo-2,6-dinitrophenyl)sulfanylaniline.
| Compound Name | 2,3-dichloro-6-(3,5-dibromo-2,6-dinitrophenyl)sulfanylaniline |
|---|---|
| PubChem CID | 10459251 |
| Molecular Formula | C12H5Br2Cl2N3O4S |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 514.77 |
| IUPAC Name | 2,3-dichloro-6-(3,5-dibromo-2,6-dinitrophenyl)sulfanylaniline |
| SMILES | Nc1c(Sc2c([N+](=O)[O-])c(Br)cc(Br)c2[N+](=O)[O-])ccc(Cl)c1Cl |
| InChI | InChI=1S/C12H5Br2Cl2N3O4S/c13-4-3-5(14)11(19(22)23)12(10(4)18(20)21)24-7-2-1-6(15)8(16)9(7)17/h1-3H,17H2 |
| InChIKey | FCOKHZVGRZELJM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|