C13H19F3N2O — CID 104622137
N-(2-cyanobutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104622137) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(2-cyanobutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-cyanobutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104622137 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(2-cyanobutan-2-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCC(C)(C#N)NC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O/c1-3-12(2,8-17)18-11(19)9-6-4-5-7-10(9)13(14,15)16/h9-10H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | WGABEASNNIMWRO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |