C14H21F3N2O — CID 104622138
N-(3-cyanopentan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 104622138) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-cyanopentan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104622138 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCC(C#N)(CC)NC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O/c1-3-13(4-2,9-18)19-12(20)10-7-5-6-8-11(10)14(15,16)17/h10-11H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | HRECNQPYZSIHOB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |