C18H25NO4 — CID 10495870
(2S)-2-[(3aR,6S,6aS)-1-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyethanol (PubChem CID 10495870) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2S)-2-[(3aR,6S,6aS)-1-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyethanol.
| Compound Name | (2S)-2-[(3aR,6S,6aS)-1-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyethanol |
|---|---|
| PubChem CID | 10495870 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (2S)-2-[(3aR,6S,6aS)-1-[(1S)-1-phenylethyl]-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazol-6-yl]-2-prop-2-enoxyethanol |
| SMILES | C=CCO[C@@H](CO)[C@H]1OC[C@@H]2CON([C@@H](C)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C18H25NO4/c1-3-9-21-16(10-20)18-17-15(11-22-18)12-23-19(17)13(2)14-7-5-4-6-8-14/h3-8,13,15-18,20H,1,9-12H2,2H3/t13-,15+,16-,17-,18+/m0/s1 |
| InChIKey | JHGQCGHSUPGDJR-SRVCANOKSA-N |
| XLogP | 1.94 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|