C25H44N2O5S — CID 10505041
(2-oxo-4-phenylazetidin-1-yl) sulfate;tetrabutylazanium (PubChem CID 10505041) has the molecular formula C25H44N2O5S and a molecular weight of 484.70 g/mol. Its IUPAC name is (2-oxo-4-phenylazetidin-1-yl) sulfate;tetrabutylazanium.
| Compound Name | (2-oxo-4-phenylazetidin-1-yl) sulfate;tetrabutylazanium |
|---|---|
| PubChem CID | 10505041 |
| Molecular Formula | C25H44N2O5S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | (2-oxo-4-phenylazetidin-1-yl) sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C1CC(c2ccccc2)N1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C9H9NO5S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;11-9-6-8(7-4-2-1-3-5-7)10(9)15-16(12,13)14/h5-16H2,1-4H3;1-5,8H,6H2,(H,12,13,14)/q+1;/p-1 |
| InChIKey | RSYGLZOOYLAEQP-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|