C28H30 — CID 10522956
6-tert-butyl-16-[(Z)-2-phenylethenyl]tricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene (PubChem CID 10522956) has the molecular formula C28H30 and a molecular weight of 366.55 g/mol. Its IUPAC name is 6-tert-butyl-16-[(Z)-2-phenylethenyl]tricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene.
| Compound Name | 6-tert-butyl-16-[(Z)-2-phenylethenyl]tricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene |
|---|---|
| PubChem CID | 10522956 |
| Molecular Formula | C28H30 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 6-tert-butyl-16-[(Z)-2-phenylethenyl]tricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene |
| SMILES | CC(C)(C)c1cc2c(/C=C\c3ccccc3)c(c1)CCc1cccc(c1)CC2 |
| InChI | InChI=1S/C28H30/c1-28(2,3)26-19-24-15-12-22-10-7-11-23(18-22)13-16-25(20-26)27(24)17-14-21-8-5-4-6-9-21/h4-11,14,17-20H,12-13,15-16H2,1-3H3/b17-14- |
| InChIKey | VOSAPJJRDKAXKX-VKAVYKQESA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|