C19H21IOSi — CID 10526138
ethenyl-[(1S,2S)-2-iodocyclopentyl]oxy-diphenylsilane (PubChem CID 10526138) has the molecular formula C19H21IOSi and a molecular weight of 420.37 g/mol. Its IUPAC name is ethenyl-[(1S,2S)-2-iodocyclopentyl]oxy-diphenylsilane.
| Compound Name | ethenyl-[(1S,2S)-2-iodocyclopentyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10526138 |
| Molecular Formula | C19H21IOSi |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | ethenyl-[(1S,2S)-2-iodocyclopentyl]oxy-diphenylsilane |
| SMILES | C=C[Si](O[C@H]1CCC[C@@H]1I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21IOSi/c1-2-22(16-10-5-3-6-11-16,17-12-7-4-8-13-17)21-19-15-9-14-18(19)20/h2-8,10-13,18-19H,1,9,14-15H2/t18-,19-/m0/s1 |
| InChIKey | WAUAFWWZOUZMAG-OALUTQOASA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|