C68H73BrCuN4O2 — CID 10534266
copper 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,3-dione (PubChem CID 10534266) has the molecular formula C68H73BrCuN4O2 and a molecular weight of 1121.81 g/mol. Its IUPAC name is copper 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,3-dione.
| Compound Name | copper 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,3-dione |
|---|---|
| PubChem CID | 10534266 |
| Molecular Formula | C68H73BrCuN4O2 |
| Molecular Weight | 1121.81 g/mol |
| Exact Mass | 1119.42 |
| IUPAC Name | copper 5-(4-bromophenyl)-10,15,20-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide-2,3-dione |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([n-]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(Br)cc5)c5ccc2[n-]5)C(=O)C4=O)C=C3)cc(C(C)(C)C)c1.[Cu+2] |
| InChI | InChI=1S/C68H75BrN4O2.Cu/c1-63(2,3)42-29-39(30-43(35-42)64(4,5)6)55-49-23-24-50(70-49)56(40-31-44(65(7,8)9)36-45(32-40)66(10,11)12)52-26-28-54(72-52)58(41-33-46(67(13,14)15)37-47(34-41)68(16,17)18)60-62(75)61(74)59(73-60)57(53-27-25-51(55)71-53)38-19-21-48(69)22-20-38;/h19-37H,1-18H3,(H2,70,71,72,73,74,75);/q;+2/p-2 |
| InChIKey | BDYFLAVAJINMLB-UHFFFAOYSA-L |
| XLogP | 18.02 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.81 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|