C17H12O4 — CID 10540687
1,8-dihydroxy-2-prop-2-enylanthracene-9,10-dione (PubChem CID 10540687) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1,8-dihydroxy-2-prop-2-enylanthracene-9,10-dione.
| Compound Name | 1,8-dihydroxy-2-prop-2-enylanthracene-9,10-dione |
|---|---|
| PubChem CID | 10540687 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1,8-dihydroxy-2-prop-2-enylanthracene-9,10-dione |
| SMILES | C=CCc1ccc2c(c1O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C17H12O4/c1-2-4-9-7-8-11-14(15(9)19)17(21)13-10(16(11)20)5-3-6-12(13)18/h2-3,5-8,18-19H,1,4H2 |
| InChIKey | CYMBUOAVRWMOOH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|