C11H14ClN3O2S — CID 10541321
[4-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]anilino]azanium chloride (PubChem CID 10541321) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is [4-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]anilino]azanium chloride.
| Compound Name | [4-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]anilino]azanium chloride |
|---|---|
| PubChem CID | 10541321 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [4-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]anilino]azanium chloride |
| SMILES | [Cl-].[NH3+]Nc1ccc(CCN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C11H13N3O2S.ClH/c12-13-9-3-1-8(2-4-9)5-6-14-10(15)7-17-11(14)16;/h1-4,13H,5-7,12H2;1H |
| InChIKey | GVBWYXFGLHMUQL-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|