C11H16N2O — CID 105446305
3-N,3-N-dimethyl-3,4-dihydro-2H-chromene-3,8-diamine (PubChem CID 105446305) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-3,4-dihydro-2H-chromene-3,8-diamine.
| Compound Name | 3-N,3-N-dimethyl-3,4-dihydro-2H-chromene-3,8-diamine |
|---|---|
| PubChem CID | 105446305 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3-N,3-N-dimethyl-3,4-dihydro-2H-chromene-3,8-diamine |
| SMILES | CN(C)C1COc2c(N)cccc2C1 |
| InChI | InChI=1S/C11H16N2O/c1-13(2)9-6-8-4-3-5-10(12)11(8)14-7-9/h3-5,9H,6-7,12H2,1-2H3 |
| InChIKey | ZVUYOIISMXDZMS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|