C10H10FNO3 — CID 105464731
4-[fluoro(isocyanato)methyl]-1,2-dimethoxybenzene (PubChem CID 105464731) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is 4-[fluoro(isocyanato)methyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[fluoro(isocyanato)methyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 105464731 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 4-[fluoro(isocyanato)methyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(C(F)N=C=O)cc1OC |
| InChI | InChI=1S/C10H10FNO3/c1-14-8-4-3-7(5-9(8)15-2)10(11)12-6-13/h3-5,10H,1-2H3 |
| InChIKey | HOYFQZMHUKCQCN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|