C17H33N3O7 — CID 10548483
(2R)-2-amino-N-[2-oxo-2-[6-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexylamino]ethyl]propanamide (PubChem CID 10548483) has the molecular formula C17H33N3O7 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-oxo-2-[6-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexylamino]ethyl]propanamide.
| Compound Name | (2R)-2-amino-N-[2-oxo-2-[6-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 10548483 |
| Molecular Formula | C17H33N3O7 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (2R)-2-amino-N-[2-oxo-2-[6-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyhexylamino]ethyl]propanamide |
| SMILES | C[C@@H]1O[C@H](OCCCCCCNC(=O)CNC(=O)[C@@H](C)N)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H33N3O7/c1-10(18)16(25)20-9-12(21)19-7-5-3-4-6-8-26-17-15(24)14(23)13(22)11(2)27-17/h10-11,13-15,17,22-24H,3-9,18H2,1-2H3,(H,19,21)(H,20,25)/t10-,11+,13-,14-,15+,17+/m1/s1 |
| InChIKey | PSPRWHOGKOTIMH-CTEBAQDESA-N |
| XLogP | -2.03 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|