C21H17N5O5 — CID 10549993
2-[2-(azidomethyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-hydroxypropyl]isoindole-1,3-dione (PubChem CID 10549993) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(azidomethyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10549993 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[2-(azidomethyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-hydroxypropyl]isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCC(CO)(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H17N5O5/c22-24-23-9-21(12-27,10-25-17(28)13-5-1-2-6-14(13)18(25)29)11-26-19(30)15-7-3-4-8-16(15)20(26)31/h1-8,27H,9-12H2 |
| InChIKey | KMMNNRJPXQGWPE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 143.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|