C13H13N7O3 — CID 10757704
2-[2,2-bis(azidomethyl)-3-hydroxypropyl]isoindole-1,3-dione (PubChem CID 10757704) has the molecular formula C13H13N7O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[2,2-bis(azidomethyl)-3-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[2,2-bis(azidomethyl)-3-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10757704 |
| Molecular Formula | C13H13N7O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[2,2-bis(azidomethyl)-3-hydroxypropyl]isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCC(CO)(CN=[N+]=[N-])CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13N7O3/c14-18-16-5-13(8-21,6-17-19-15)7-20-11(22)9-3-1-2-4-10(9)12(20)23/h1-4,21H,5-8H2 |
| InChIKey | VKWHXWRNRWNFQW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 155.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|