C15H17F2NO3 — CID 106253994
2-[2-ethyl-2-(hydroxymethyl)butyl]-5,6-difluoroisoindole-1,3-dione (PubChem CID 106253994) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-[2-ethyl-2-(hydroxymethyl)butyl]-5,6-difluoroisoindole-1,3-dione.
| Compound Name | 2-[2-ethyl-2-(hydroxymethyl)butyl]-5,6-difluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 106253994 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[2-ethyl-2-(hydroxymethyl)butyl]-5,6-difluoroisoindole-1,3-dione |
| SMILES | CCC(CC)(CO)CN1C(=O)c2cc(F)c(F)cc2C1=O |
| InChI | InChI=1S/C15H17F2NO3/c1-3-15(4-2,8-19)7-18-13(20)9-5-11(16)12(17)6-10(9)14(18)21/h5-6,19H,3-4,7-8H2,1-2H3 |
| InChIKey | ZTKUKXLLNCVKQG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|