C25H48O4Si — CID 10551113
(2R,3Z,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol (PubChem CID 10551113) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is (2R,3Z,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol.
| Compound Name | (2R,3Z,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 10551113 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (2R,3Z,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-ol |
| SMILES | COCOC(C)(C)CCC/C=C1\[C@H](O)C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O4Si/c1-23(2,3)30(8,9)29-22-14-12-16-25(6)19(21(26)17-20(22)25)13-10-11-15-24(4,5)28-18-27-7/h13,20-22,26H,10-12,14-18H2,1-9H3/b19-13+/t20-,21+,22-,25+/m0/s1 |
| InChIKey | BXGNBMQAEIYOFJ-XHSMUJQFSA-N |
| XLogP | 6.44 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|