C31H45NO5SSi — CID 10555101
tert-butyl-[(S)-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(3-methyl-1,3-thiazolidin-2-yl)methoxy]-diphenylsilane (PubChem CID 10555101) has the molecular formula C31H45NO5SSi and a molecular weight of 571.86 g/mol. Its IUPAC name is tert-butyl-[(S)-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(3-methyl-1,3-thiazolidin-2-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(S)-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(3-methyl-1,3-thiazolidin-2-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10555101 |
| Molecular Formula | C31H45NO5SSi |
| Molecular Weight | 571.86 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | tert-butyl-[(S)-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-(3-methyl-1,3-thiazolidin-2-yl)methoxy]-diphenylsilane |
| SMILES | CN1CCSC1[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C31H45NO5SSi/c1-29(2,3)39(22-15-11-9-12-16-22,23-17-13-10-14-18-23)37-27(28-32(8)19-20-38-28)26-25(35-31(6,7)36-26)24-21-33-30(4,5)34-24/h9-18,24-28H,19-21H2,1-8H3/t24-,25+,26-,27-,28?/m0/s1 |
| InChIKey | UERQZWFCUYHDNO-KINFFZBNSA-N |
| XLogP | 4.61 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|