C28H33NO12 — CID 10555162
methyl 2-acetamido-3-[4-[2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethynyl]phenyl]propanoate (PubChem CID 10555162) has the molecular formula C28H33NO12 and a molecular weight of 575.57 g/mol. Its IUPAC name is methyl 2-acetamido-3-[4-[2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethynyl]phenyl]propanoate.
| Compound Name | methyl 2-acetamido-3-[4-[2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethynyl]phenyl]propanoate |
|---|---|
| PubChem CID | 10555162 |
| Molecular Formula | C28H33NO12 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | methyl 2-acetamido-3-[4-[2-[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]ethynyl]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(C#C[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1)NC(C)=O |
| InChI | InChI=1S/C28H33NO12/c1-15(30)29-22(28(35)36-6)13-21-9-7-20(8-10-21)11-12-23-25(38-17(3)32)27(40-19(5)34)26(39-18(4)33)24(41-23)14-37-16(2)31/h7-10,22-27H,13-14H2,1-6H3,(H,29,30)/t22?,23-,24+,25-,26+,27+/m0/s1 |
| InChIKey | JBWXOEGQOKPJNS-GYVOAOTASA-N |
| XLogP | 0.38 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|