C44H70O8Si3 — CID 10557354
(1R,5S,6S,10R,11S,12R)-5,6-bis(phenylmethoxy)-10-triethylsilyloxy-11,12-bis(2-trimethylsilylethoxymethoxy)cyclododeca-3,7-diyn-1-ol (PubChem CID 10557354) has the molecular formula C44H70O8Si3 and a molecular weight of 811.29 g/mol. Its IUPAC name is (1R,5S,6S,10R,11S,12R)-5,6-bis(phenylmethoxy)-10-triethylsilyloxy-11,12-bis(2-trimethylsilylethoxymethoxy)cyclododeca-3,7-diyn-1-ol.
| Compound Name | (1R,5S,6S,10R,11S,12R)-5,6-bis(phenylmethoxy)-10-triethylsilyloxy-11,12-bis(2-trimethylsilylethoxymethoxy)cyclododeca-3,7-diyn-1-ol |
|---|---|
| PubChem CID | 10557354 |
| Molecular Formula | C44H70O8Si3 |
| Molecular Weight | 811.29 g/mol |
| Exact Mass | 810.44 |
| IUPAC Name | (1R,5S,6S,10R,11S,12R)-5,6-bis(phenylmethoxy)-10-triethylsilyloxy-11,12-bis(2-trimethylsilylethoxymethoxy)cyclododeca-3,7-diyn-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC#C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C#CC[C@@H](O)[C@@H](OCOCC[Si](C)(C)C)[C@@H]1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C44H70O8Si3/c1-10-55(11-2,12-3)52-42-28-20-27-41(49-34-38-23-17-14-18-24-38)40(48-33-37-21-15-13-16-22-37)26-19-25-39(45)43(50-35-46-29-31-53(4,5)6)44(42)51-36-47-30-32-54(7,8)9/h13-18,21-24,39-45H,10-12,25,28-36H2,1-9H3/t39-,40+,41+,42-,43-,44-/m1/s1 |
| InChIKey | NMLFUAORIMDMBP-MXOMBLRVSA-N |
| XLogP | 9.10 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.29 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|