C8H14O4 — CID 10559135
(1S,7S)-8,9,11,12-tetraoxabicyclo[5.4.1]dodecane (PubChem CID 10559135) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1S,7S)-8,9,11,12-tetraoxabicyclo[5.4.1]dodecane.
| Compound Name | (1S,7S)-8,9,11,12-tetraoxabicyclo[5.4.1]dodecane |
|---|---|
| PubChem CID | 10559135 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (1S,7S)-8,9,11,12-tetraoxabicyclo[5.4.1]dodecane |
| SMILES | C1CC[C@@H]2OOCO[C@H](CC1)O2 |
| InChI | InChI=1S/C8H14O4/c1-2-4-7-9-6-10-12-8(11-7)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | GAGLBLPMLLAYBD-YUMQZZPRSA-N |
| XLogP | 1.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|