C18H21NO3S — CID 10568664
[(1S,3S,4R,6R,8S)-3-cyano-4-tricyclo[4.3.1.03,8]decanyl] 4-methylbenzenesulfonate (PubChem CID 10568664) has the molecular formula C18H21NO3S and a molecular weight of 333.44 g/mol. Its IUPAC name is [(1S,3S,4R,6R,8S)-3-cyano-4-tricyclo[4.3.1.03,8]decanyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3S,4R,6R,8S)-3-cyano-4-tricyclo[4.3.1.03,8]decanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10568664 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(1S,3S,4R,6R,8S)-3-cyano-4-tricyclo[4.3.1.03,8]decanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[18O][C@@H]2C[C@@H]3C[C@H]4C[C@@H](C3)[C@]2(C#N)C4)cc1 |
| InChI | InChI=1S/C18H21NO3S/c1-12-2-4-16(5-3-12)23(20,21)22-17-9-13-6-14-8-15(7-13)18(17,10-14)11-19/h2-5,13-15,17H,6-10H2,1H3/t13-,14+,15-,17-,18-/m1/s1/i22+2 |
| InChIKey | GJKXRFKHFJZWOH-NSAOBINVSA-N |
| XLogP | 3.42 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|