C18H23F3O4S — CID 10572591
(2-ethoxy-1,1,1-trifluoro-2-methoxy-6,6-dimethylhepta-3,4-dien-3-yl)sulfonylbenzene (PubChem CID 10572591) has the molecular formula C18H23F3O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is (2-ethoxy-1,1,1-trifluoro-2-methoxy-6,6-dimethylhepta-3,4-dien-3-yl)sulfonylbenzene.
| Compound Name | (2-ethoxy-1,1,1-trifluoro-2-methoxy-6,6-dimethylhepta-3,4-dien-3-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 10572591 |
| Molecular Formula | C18H23F3O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (2-ethoxy-1,1,1-trifluoro-2-methoxy-6,6-dimethylhepta-3,4-dien-3-yl)sulfonylbenzene |
| SMILES | CCOC(OC)(C(=C=CC(C)(C)C)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H23F3O4S/c1-6-25-17(24-5,18(19,20)21)15(12-13-16(2,3)4)26(22,23)14-10-8-7-9-11-14/h7-11,13H,6H2,1-5H3 |
| InChIKey | JECQKJDBZVCJOC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|