C20H23F3O4S — CID 10621828
(2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-4-methylidene-2-(trifluoromethyl)oxolane (PubChem CID 10621828) has the molecular formula C20H23F3O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-4-methylidene-2-(trifluoromethyl)oxolane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-4-methylidene-2-(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 10621828 |
| Molecular Formula | C20H23F3O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-3-(3,3-dimethylbut-1-ynyl)-2-ethoxy-4-methylidene-2-(trifluoromethyl)oxolane |
| SMILES | C=C1CO[C@@](OCC)(C(F)(F)F)[C@@]1(C#CC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23F3O4S/c1-6-26-19(20(21,22)23)18(15(2)14-27-19,13-12-17(3,4)5)28(24,25)16-10-8-7-9-11-16/h7-11H,2,6,14H2,1,3-5H3/t18-,19+/m0/s1 |
| InChIKey | GQZKARYRYKDTEX-RBUKOAKNSA-N |
| XLogP | 4.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|