C27H27F3O4S — CID 10625324
(2S,3S)-3-(benzenesulfonyl)-2-ethoxy-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)-1-oxaspiro[4.5]decane (PubChem CID 10625324) has the molecular formula C27H27F3O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)-1-oxaspiro[4.5]decane.
| Compound Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)-1-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10625324 |
| Molecular Formula | C27H27F3O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (2S,3S)-3-(benzenesulfonyl)-2-ethoxy-4-methylidene-3-(2-phenylethynyl)-2-(trifluoromethyl)-1-oxaspiro[4.5]decane |
| SMILES | C=C1C2(CCCCC2)O[C@@](OCC)(C(F)(F)F)[C@@]1(C#Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27F3O4S/c1-3-33-26(27(28,29)30)25(20-17-22-13-7-4-8-14-22,35(31,32)23-15-9-5-10-16-23)21(2)24(34-26)18-11-6-12-19-24/h4-5,7-10,13-16H,2-3,6,11-12,18-19H2,1H3/t25-,26+/m0/s1 |
| InChIKey | ACCWRPZHBNWKFD-IZZNHLLZSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|